C26H29BrN3O3+ — CID 6996694
3-[[3-[5-(4-bromophenyl)furan-2-yl]-2-[(4-methylbenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium (PubChem CID 6996694) has the molecular formula C26H29BrN3O3+ and a molecular weight of 511.44 g/mol. Its IUPAC name is 3-[[3-[5-(4-bromophenyl)furan-2-yl]-2-[(4-methylbenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[3-[5-(4-bromophenyl)furan-2-yl]-2-[(4-methylbenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 6996694 |
| Molecular Formula | C26H29BrN3O3+ |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 3-[[3-[5-(4-bromophenyl)furan-2-yl]-2-[(4-methylbenzoyl)amino]prop-2-enoyl]amino]propyl-dimethylazanium |
| SMILES | Cc1ccc(C(=O)NC(=Cc2ccc(-c3ccc(Br)cc3)o2)C(=O)NCCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C26H28BrN3O3/c1-18-5-7-20(8-6-18)25(31)29-23(26(32)28-15-4-16-30(2)3)17-22-13-14-24(33-22)19-9-11-21(27)12-10-19/h5-14,17H,4,15-16H2,1-3H3,(H,28,32)(H,29,31)/p+1 |
| InChIKey | IFTAUFOEDCOUKF-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|