C29H31ClF3N3O3 — CID 3227852
N-[1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-3-[3-(diethylamino)propylamino]-3-oxoprop-1-en-2-yl]-4-methylbenzamide (PubChem CID 3227852) has the molecular formula C29H31ClF3N3O3 and a molecular weight of 562.03 g/mol. Its IUPAC name is N-[1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-3-[3-(diethylamino)propylamino]-3-oxoprop-1-en-2-yl]-4-methylbenzamide.
| Compound Name | N-[1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-3-[3-(diethylamino)propylamino]-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3227852 |
| Molecular Formula | C29H31ClF3N3O3 |
| Molecular Weight | 562.03 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | N-[1-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-3-[3-(diethylamino)propylamino]-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
| SMILES | CCN(CC)CCCNC(=O)C(=Cc1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H31ClF3N3O3/c1-4-36(5-2)16-6-15-34-28(38)25(35-27(37)20-9-7-19(3)8-10-20)18-22-12-14-26(39-22)23-17-21(29(31,32)33)11-13-24(23)30/h7-14,17-18H,4-6,15-16H2,1-3H3,(H,34,38)(H,35,37) |
| InChIKey | QSSDICIWRIXHAN-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.03 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|