C27H22ClF3N4O3 — CID 3522232
4-chloro-N-[3-(3-imidazol-1-ylpropylamino)-3-oxo-1-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-1-en-2-yl]benzamide (PubChem CID 3522232) has the molecular formula C27H22ClF3N4O3 and a molecular weight of 542.95 g/mol. Its IUPAC name is 4-chloro-N-[3-(3-imidazol-1-ylpropylamino)-3-oxo-1-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-1-en-2-yl]benzamide.
| Compound Name | 4-chloro-N-[3-(3-imidazol-1-ylpropylamino)-3-oxo-1-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3522232 |
| Molecular Formula | C27H22ClF3N4O3 |
| Molecular Weight | 542.95 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 4-chloro-N-[3-(3-imidazol-1-ylpropylamino)-3-oxo-1-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-1-en-2-yl]benzamide |
| SMILES | O=C(NCCCn1ccnc1)C(=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22ClF3N4O3/c28-21-7-5-18(6-8-21)25(36)34-23(26(37)33-11-2-13-35-14-12-32-17-35)16-22-9-10-24(38-22)19-3-1-4-20(15-19)27(29,30)31/h1,3-10,12,14-17H,2,11,13H2,(H,33,37)(H,34,36) |
| InChIKey | MMAXJDYDAAMMLO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.95 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|