C26H23N5O5 — CID 3490681
N-[3-(3-imidazol-1-ylpropylamino)-1-[5-(3-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3490681) has the molecular formula C26H23N5O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is N-[3-(3-imidazol-1-ylpropylamino)-1-[5-(3-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-(3-imidazol-1-ylpropylamino)-1-[5-(3-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3490681 |
| Molecular Formula | C26H23N5O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-[3-(3-imidazol-1-ylpropylamino)-1-[5-(3-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCCCn1ccnc1)C(=Cc1ccc(-c2cccc([N+](=O)[O-])c2)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H23N5O5/c32-25(19-6-2-1-3-7-19)29-23(26(33)28-12-5-14-30-15-13-27-18-30)17-22-10-11-24(36-22)20-8-4-9-21(16-20)31(34)35/h1-4,6-11,13,15-18H,5,12,14H2,(H,28,33)(H,29,32) |
| InChIKey | YYJWXGFTAYWOPA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|