C27H25N5O5 — CID 2926909
N-[3-(3-imidazol-1-ylpropylamino)-1-[5-(2-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide (PubChem CID 2926909) has the molecular formula C27H25N5O5 and a molecular weight of 499.53 g/mol. Its IUPAC name is N-[3-(3-imidazol-1-ylpropylamino)-1-[5-(2-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide.
| Compound Name | N-[3-(3-imidazol-1-ylpropylamino)-1-[5-(2-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 2926909 |
| Molecular Formula | C27H25N5O5 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[3-(3-imidazol-1-ylpropylamino)-1-[5-(2-nitrophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=Cc2ccc(-c3ccccc3[N+](=O)[O-])o2)C(=O)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C27H25N5O5/c1-19-7-9-20(10-8-19)26(33)30-23(27(34)29-13-4-15-31-16-14-28-18-31)17-21-11-12-25(37-21)22-5-2-3-6-24(22)32(35)36/h2-3,5-12,14,16-18H,4,13,15H2,1H3,(H,29,34)(H,30,33) |
| InChIKey | OFULDLDXRNWSDO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|