C22H24N4O2S — CID 6618306
N-[3-(3-imidazol-1-ylpropylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide (PubChem CID 6618306) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is N-[3-(3-imidazol-1-ylpropylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[3-(3-imidazol-1-ylpropylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 6618306 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[3-(3-imidazol-1-ylpropylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=Cc2cccs2)C(=O)NCCCn2ccnc2)cc1C |
| InChI | InChI=1S/C22H24N4O2S/c1-16-6-7-18(13-17(16)2)21(27)25-20(14-19-5-3-12-29-19)22(28)24-8-4-10-26-11-9-23-15-26/h3,5-7,9,11-15H,4,8,10H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | DAMQEHPKMYHQKH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|