C31H28N4O4S2 — CID 139228872
N-[(E)-3-[3-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]propylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 139228872) has the molecular formula C31H28N4O4S2 and a molecular weight of 584.72 g/mol. Its IUPAC name is N-[(E)-3-[3-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]propylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]propylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 139228872 |
| Molecular Formula | C31H28N4O4S2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | N-[(E)-3-[3-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]propylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCCCNC(=O)/C(=C\c1cccs1)NC(=O)c1ccccc1)/C(=C\c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H28N4O4S2/c36-28(22-10-3-1-4-11-22)34-26(20-24-14-7-18-40-24)30(38)32-16-9-17-33-31(39)27(21-25-15-8-19-41-25)35-29(37)23-12-5-2-6-13-23/h1-8,10-15,18-21H,9,16-17H2,(H,32,38)(H,33,39)(H,34,36)(H,35,37)/b26-20+,27-21+ |
| InChIKey | LAXWGUXLGXKWGX-CRYYDKFDSA-N |
| XLogP | 4.67 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|