C20H16N2O3S — CID 22303810
N-[(Z)-3-(2-hydroxyanilino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 22303810) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[(Z)-3-(2-hydroxyanilino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-(2-hydroxyanilino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22303810 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[(Z)-3-(2-hydroxyanilino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccccc1O)/C(=C/c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O3S/c23-18-11-5-4-10-16(18)21-20(25)17(13-15-9-6-12-26-15)22-19(24)14-7-2-1-3-8-14/h1-13,23H,(H,21,25)(H,22,24)/b17-13- |
| InChIKey | KHSHJBHGZLIVAD-LGMDPLHJSA-N |
| XLogP | 3.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|