C24H28N2O2S — CID 5112379
N-[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide (PubChem CID 5112379) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 5112379 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=Cc2cccs2)C(=O)NCCC2=CCCCC2)cc1C |
| InChI | InChI=1S/C24H28N2O2S/c1-17-10-11-20(15-18(17)2)23(27)26-22(16-21-9-6-14-29-21)24(28)25-13-12-19-7-4-3-5-8-19/h6-7,9-11,14-16H,3-5,8,12-13H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | IISKRGQKQINRGO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|