C24H22N2O3S — CID 4687840
N-[3-(3-acetylanilino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide (PubChem CID 4687840) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[3-(3-acetylanilino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[3-(3-acetylanilino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 4687840 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[3-(3-acetylanilino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3,4-dimethylbenzamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(=Cc2cccs2)NC(=O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C24H22N2O3S/c1-15-9-10-19(12-16(15)2)23(28)26-22(14-21-8-5-11-30-21)24(29)25-20-7-4-6-18(13-20)17(3)27/h4-14H,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | JWUQVTQUDISKLY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|