C26H28N2O3S — CID 100636467
N-[(Z)-3-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3-methylbenzamide (PubChem CID 100636467) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[(Z)-3-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3-methylbenzamide.
| Compound Name | N-[(Z)-3-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 100636467 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[(Z)-3-[[(2R)-1-(3,4-dimethylphenoxy)propan-2-yl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N/C(=C\c2cccs2)C(=O)N[C@H](C)COc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C26H28N2O3S/c1-17-7-5-8-21(13-17)25(29)28-24(15-23-9-6-12-32-23)26(30)27-20(4)16-31-22-11-10-18(2)19(3)14-22/h5-15,20H,16H2,1-4H3,(H,27,30)(H,28,29)/b24-15-/t20-/m1/s1 |
| InChIKey | HJFVWWJYXXEGAV-ZOLHPDHPSA-N |
| XLogP | 5.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|