C25H26N2O3S — CID 133184847
3-methyl-N-[(Z)-3-[1-(4-methylphenoxy)propan-2-ylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 133184847) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 3-methyl-N-[(Z)-3-[1-(4-methylphenoxy)propan-2-ylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | 3-methyl-N-[(Z)-3-[1-(4-methylphenoxy)propan-2-ylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 133184847 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 3-methyl-N-[(Z)-3-[1-(4-methylphenoxy)propan-2-ylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(OCC(C)NC(=O)/C(=C/c2cccs2)NC(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C25H26N2O3S/c1-17-9-11-21(12-10-17)30-16-19(3)26-25(29)23(15-22-8-5-13-31-22)27-24(28)20-7-4-6-18(2)14-20/h4-15,19H,16H2,1-3H3,(H,26,29)(H,27,28)/b23-15- |
| InChIKey | HPWYPXOQSZSMKW-HAHDFKILSA-N |
| XLogP | 4.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|