C25H26N2O2S — CID 133184749
3-methyl-N-[(Z)-3-oxo-3-(4-phenylbutan-2-ylamino)-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 133184749) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is 3-methyl-N-[(Z)-3-oxo-3-(4-phenylbutan-2-ylamino)-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | 3-methyl-N-[(Z)-3-oxo-3-(4-phenylbutan-2-ylamino)-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 133184749 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 3-methyl-N-[(Z)-3-oxo-3-(4-phenylbutan-2-ylamino)-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(C(=O)N/C(=C\c2cccs2)C(=O)NC(C)CCc2ccccc2)c1 |
| InChI | InChI=1S/C25H26N2O2S/c1-18-8-6-11-21(16-18)24(28)27-23(17-22-12-7-15-30-22)25(29)26-19(2)13-14-20-9-4-3-5-10-20/h3-12,15-17,19H,13-14H2,1-2H3,(H,26,29)(H,27,28)/b23-17- |
| InChIKey | YDPBRNAKTFQHDP-QJOMJCCJSA-N |
| XLogP | 4.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|