C24H24N2O2S — CID 133219201
3-methyl-N-[(Z)-3-oxo-3-(1-phenylpropylamino)-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 133219201) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 3-methyl-N-[(Z)-3-oxo-3-(1-phenylpropylamino)-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | 3-methyl-N-[(Z)-3-oxo-3-(1-phenylpropylamino)-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 133219201 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-methyl-N-[(Z)-3-oxo-3-(1-phenylpropylamino)-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | CCC(NC(=O)/C(=C/c1cccs1)NC(=O)c1cccc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O2S/c1-3-21(18-10-5-4-6-11-18)25-24(28)22(16-20-13-8-14-29-20)26-23(27)19-12-7-9-17(2)15-19/h4-16,21H,3H2,1-2H3,(H,25,28)(H,26,27)/b22-16- |
| InChIKey | WERIJDBYCZUPSP-JWGURIENSA-N |
| XLogP | 5.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|