C23H20N2O4S — CID 42559145
(2R)-2-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]-3-phenylpropanoic acid (PubChem CID 42559145) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is (2R)-2-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 42559145 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (2R)-2-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)O)/C(=C\c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O4S/c26-21(17-10-5-2-6-11-17)24-19(15-18-12-7-13-30-18)22(27)25-20(23(28)29)14-16-8-3-1-4-9-16/h1-13,15,20H,14H2,(H,24,26)(H,25,27)(H,28,29)/b19-15+/t20-/m1/s1 |
| InChIKey | VILADZIXPVMATB-ZWUNQBBJSA-N |
| XLogP | 3.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|