C27H26Cl2N2O3 — CID 21178678
N-[(E)-3-(azepan-1-yl)-1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide (PubChem CID 21178678) has the molecular formula C27H26Cl2N2O3 and a molecular weight of 497.42 g/mol. Its IUPAC name is N-[(E)-3-(azepan-1-yl)-1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide.
| Compound Name | N-[(E)-3-(azepan-1-yl)-1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 21178678 |
| Molecular Formula | C27H26Cl2N2O3 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | N-[(E)-3-(azepan-1-yl)-1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=C/c2ccc(-c3cc(Cl)ccc3Cl)o2)C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C27H26Cl2N2O3/c1-18-6-8-19(9-7-18)26(32)30-24(27(33)31-14-4-2-3-5-15-31)17-21-11-13-25(34-21)22-16-20(28)10-12-23(22)29/h6-13,16-17H,2-5,14-15H2,1H3,(H,30,32)/b24-17+ |
| InChIKey | IBMTXFYIHPGDRD-JJIBRWJFSA-N |
| XLogP | 6.74 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|