C20H20Cl2N2O3 — CID 45069037
N-[(Z)-3-(azepan-1-yl)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-2,4-dichlorobenzamide (PubChem CID 45069037) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is N-[(Z)-3-(azepan-1-yl)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[(Z)-3-(azepan-1-yl)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 45069037 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[(Z)-3-(azepan-1-yl)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-2,4-dichlorobenzamide |
| SMILES | O=C(N/C(=C\c1ccco1)C(=O)N1CCCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H20Cl2N2O3/c21-14-7-8-16(17(22)12-14)19(25)23-18(13-15-6-5-11-27-15)20(26)24-9-3-1-2-4-10-24/h5-8,11-13H,1-4,9-10H2,(H,23,25)/b18-13- |
| InChIKey | PZYOIYGJRMYNCV-AQTBWJFISA-N |
| XLogP | 4.76 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|