C17H20N3O4+ — CID 7349133
N-[(E)-1-(furan-2-yl)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxoprop-1-en-2-yl]furan-2-carboxamide (PubChem CID 7349133) has the molecular formula C17H20N3O4+ and a molecular weight of 330.36 g/mol. Its IUPAC name is N-[(E)-1-(furan-2-yl)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxoprop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | N-[(E)-1-(furan-2-yl)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 7349133 |
| Molecular Formula | C17H20N3O4+ |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-[(E)-1-(furan-2-yl)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
| SMILES | C[NH+]1CCN(C(=O)/C(=C\c2ccco2)NC(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H19N3O4/c1-19-6-8-20(9-7-19)17(22)14(12-13-4-2-10-23-13)18-16(21)15-5-3-11-24-15/h2-5,10-12H,6-9H2,1H3,(H,18,21)/p+1/b14-12+ |
| InChIKey | XLAPPGWXYKKUKX-WYMLVPIESA-O |
| XLogP | 0.00 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|