C18H18N2O3 — CID 5409301
N-[(E)-1-(furan-2-yl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]benzamide (PubChem CID 5409301) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-[(E)-1-(furan-2-yl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(furan-2-yl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5409301 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[(E)-1-(furan-2-yl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(N/C(=C/c1ccco1)C(=O)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O3/c21-17(14-7-2-1-3-8-14)19-16(13-15-9-6-12-23-15)18(22)20-10-4-5-11-20/h1-3,6-9,12-13H,4-5,10-11H2,(H,19,21)/b16-13+ |
| InChIKey | UPXGNBTWILBIJD-DTQAZKPQSA-N |
| XLogP | 2.67 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|