C22H26N2O3S — CID 86942676
N-[(Z)-3-(3-ethylsulfanylazepan-1-yl)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 86942676) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[(Z)-3-(3-ethylsulfanylazepan-1-yl)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-(3-ethylsulfanylazepan-1-yl)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 86942676 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[(Z)-3-(3-ethylsulfanylazepan-1-yl)-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCSC1CCCCN(C(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C22H26N2O3S/c1-2-28-19-12-6-7-13-24(16-19)22(26)20(15-18-11-8-14-27-18)23-21(25)17-9-4-3-5-10-17/h3-5,8-11,14-15,19H,2,6-7,12-13,16H2,1H3,(H,23,25)/b20-15- |
| InChIKey | FXRFKFBYUXNVKH-HKWRFOASSA-N |
| XLogP | 4.18 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|