C25H23FN2O4 — CID 86958535
N-[(Z)-3-[4-(4-fluorophenoxy)piperidin-1-yl]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 86958535) has the molecular formula C25H23FN2O4 and a molecular weight of 434.47 g/mol. Its IUPAC name is N-[(Z)-3-[4-(4-fluorophenoxy)piperidin-1-yl]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-(4-fluorophenoxy)piperidin-1-yl]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 86958535 |
| Molecular Formula | C25H23FN2O4 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[(Z)-3-[4-(4-fluorophenoxy)piperidin-1-yl]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(N/C(=C\c1ccco1)C(=O)N1CCC(Oc2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H23FN2O4/c26-19-8-10-20(11-9-19)32-21-12-14-28(15-13-21)25(30)23(17-22-7-4-16-31-22)27-24(29)18-5-2-1-3-6-18/h1-11,16-17,21H,12-15H2,(H,27,29)/b23-17- |
| InChIKey | MBVVBAHFBUOBEY-QJOMJCCJSA-N |
| XLogP | 4.26 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|