C23H29N3O3 — CID 143034758
N-[(Z)-1-(furan-2-yl)-3-(5-methyl-1,5-diazocan-1-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethylbenzamide (PubChem CID 143034758) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-(5-methyl-1,5-diazocan-1-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-(5-methyl-1,5-diazocan-1-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 143034758 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-(5-methyl-1,5-diazocan-1-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=C\c2ccco2)C(=O)N2CCCN(C)CCC2)cc1C |
| InChI | InChI=1S/C23H29N3O3/c1-17-8-9-19(15-18(17)2)22(27)24-21(16-20-7-4-14-29-20)23(28)26-12-5-10-25(3)11-6-13-26/h4,7-9,14-16H,5-6,10-13H2,1-3H3,(H,24,27)/b21-16- |
| InChIKey | LRNVYWYERLPFDZ-PGMHBOJBSA-N |
| XLogP | 3.22 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|