C24H28ClN3O2 — CID 7460248
N-[(E)-3-(azepan-1-yl)-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-2-chlorobenzamide (PubChem CID 7460248) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is N-[(E)-3-(azepan-1-yl)-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-2-chlorobenzamide.
| Compound Name | N-[(E)-3-(azepan-1-yl)-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 7460248 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N-[(E)-3-(azepan-1-yl)-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
| SMILES | CN(C)c1ccc(/C=C(/NC(=O)c2ccccc2Cl)C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C24H28ClN3O2/c1-27(2)19-13-11-18(12-14-19)17-22(24(30)28-15-7-3-4-8-16-28)26-23(29)20-9-5-6-10-21(20)25/h5-6,9-14,17H,3-4,7-8,15-16H2,1-2H3,(H,26,29)/b22-17+ |
| InChIKey | RFSKSWFLZKBTAR-OQKWZONESA-N |
| XLogP | 4.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|