C21H23ClN3O2+ — CID 2100668
N-[(Z)-1-(4-chlorophenyl)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 2100668) has the molecular formula C21H23ClN3O2+ and a molecular weight of 384.89 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 2100668 |
| Molecular Formula | C21H23ClN3O2+ |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | C[NH+]1CCN(C(=O)/C(=C/c2ccc(Cl)cc2)NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H22ClN3O2/c1-24-11-13-25(14-12-24)21(27)19(15-16-7-9-18(22)10-8-16)23-20(26)17-5-3-2-4-6-17/h2-10,15H,11-14H2,1H3,(H,23,26)/p+1/b19-15- |
| InChIKey | CZNRMLFUROBSKK-CYVLTUHYSA-O |
| XLogP | 1.47 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|