C21H23N4O4+ — CID 7405920
N-[(Z)-3-(4-methylpiperazin-4-ium-1-yl)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 7405920) has the molecular formula C21H23N4O4+ and a molecular weight of 395.44 g/mol. Its IUPAC name is N-[(Z)-3-(4-methylpiperazin-4-ium-1-yl)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-(4-methylpiperazin-4-ium-1-yl)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 7405920 |
| Molecular Formula | C21H23N4O4+ |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[(Z)-3-(4-methylpiperazin-4-ium-1-yl)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | C[NH+]1CCN(C(=O)/C(=C/c2ccc([N+](=O)[O-])cc2)NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H22N4O4/c1-23-11-13-24(14-12-23)21(27)19(22-20(26)17-5-3-2-4-6-17)15-16-7-9-18(10-8-16)25(28)29/h2-10,15H,11-14H2,1H3,(H,22,26)/p+1/b19-15- |
| InChIKey | VXTXCPRGZJUJES-CYVLTUHYSA-O |
| XLogP | 0.72 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|