C22H26N3O2S+ — CID 7285143
N-[(E)-3-(4-methylpiperazin-4-ium-1-yl)-1-(4-methylsulfanylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 7285143) has the molecular formula C22H26N3O2S+ and a molecular weight of 396.54 g/mol. Its IUPAC name is N-[(E)-3-(4-methylpiperazin-4-ium-1-yl)-1-(4-methylsulfanylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-(4-methylpiperazin-4-ium-1-yl)-1-(4-methylsulfanylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 7285143 |
| Molecular Formula | C22H26N3O2S+ |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[(E)-3-(4-methylpiperazin-4-ium-1-yl)-1-(4-methylsulfanylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CSc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)N2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O2S/c1-24-12-14-25(15-13-24)22(27)20(16-17-8-10-19(28-2)11-9-17)23-21(26)18-6-4-3-5-7-18/h3-11,16H,12-15H2,1-2H3,(H,23,26)/p+1/b20-16+ |
| InChIKey | ILGFAGCIZCYDBW-CAPFRKAQSA-O |
| XLogP | 1.54 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|