C19H18ClN3O3 — CID 3850864
2-chloro-N-(3-morpholin-4-yl-3-oxo-1-pyridin-3-ylprop-1-en-2-yl)benzamide (PubChem CID 3850864) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is 2-chloro-N-(3-morpholin-4-yl-3-oxo-1-pyridin-3-ylprop-1-en-2-yl)benzamide.
| Compound Name | 2-chloro-N-(3-morpholin-4-yl-3-oxo-1-pyridin-3-ylprop-1-en-2-yl)benzamide |
|---|---|
| PubChem CID | 3850864 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-chloro-N-(3-morpholin-4-yl-3-oxo-1-pyridin-3-ylprop-1-en-2-yl)benzamide |
| SMILES | O=C(NC(=Cc1cccnc1)C(=O)N1CCOCC1)c1ccccc1Cl |
| InChI | InChI=1S/C19H18ClN3O3/c20-16-6-2-1-5-15(16)18(24)22-17(12-14-4-3-7-21-13-14)19(25)23-8-10-26-11-9-23/h1-7,12-13H,8-11H2,(H,22,24) |
| InChIKey | GVYTXZQSVOHGDN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|