C24H25ClN4O4S — CID 24791584
2-chloro-N-[(Z)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]benzamide (PubChem CID 24791584) has the molecular formula C24H25ClN4O4S and a molecular weight of 501.01 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(Z)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 24791584 |
| Molecular Formula | C24H25ClN4O4S |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 2-chloro-N-[(Z)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]benzamide |
| SMILES | CN(C)S(=O)(=O)n1cc(/C=C(\NC(=O)c2ccccc2Cl)C(=O)N2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C24H25ClN4O4S/c1-27(2)34(32,33)29-16-17(18-9-4-6-12-22(18)29)15-21(24(31)28-13-7-8-14-28)26-23(30)19-10-3-5-11-20(19)25/h3-6,9-12,15-16H,7-8,13-14H2,1-2H3,(H,26,30)/b21-15- |
| InChIKey | BIXGZFSUBFKXTC-QNGOZBTKSA-N |
| XLogP | 3.34 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|