C27H32N4O4S — CID 46262034
N-[(Z)-3-(azepan-1-yl)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide (PubChem CID 46262034) has the molecular formula C27H32N4O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is N-[(Z)-3-(azepan-1-yl)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide.
| Compound Name | N-[(Z)-3-(azepan-1-yl)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 46262034 |
| Molecular Formula | C27H32N4O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | N-[(Z)-3-(azepan-1-yl)-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=C\c2cn(S(=O)(=O)N(C)C)c3ccccc23)C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C27H32N4O4S/c1-20-12-14-21(15-13-20)26(32)28-24(27(33)30-16-8-4-5-9-17-30)18-22-19-31(36(34,35)29(2)3)25-11-7-6-10-23(22)25/h6-7,10-15,18-19H,4-5,8-9,16-17H2,1-3H3,(H,28,32)/b24-18- |
| InChIKey | JSQSMMCPXMETOO-MOHJPFBDSA-N |
| XLogP | 3.78 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|