C25H31N5O4S — CID 71965047
N-[3-[3-(dimethylamino)propylamino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 71965047) has the molecular formula C25H31N5O4S and a molecular weight of 497.62 g/mol. Its IUPAC name is N-[3-[3-(dimethylamino)propylamino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[3-(dimethylamino)propylamino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 71965047 |
| Molecular Formula | C25H31N5O4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[3-[3-(dimethylamino)propylamino]-1-[1-(dimethylsulfamoyl)indol-3-yl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN(C)CCCNC(=O)C(=Cc1cn(S(=O)(=O)N(C)C)c2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H31N5O4S/c1-28(2)16-10-15-26-25(32)22(27-24(31)19-11-6-5-7-12-19)17-20-18-30(35(33,34)29(3)4)23-14-9-8-13-21(20)23/h5-9,11-14,17-18H,10,15-16H2,1-4H3,(H,26,32)(H,27,31) |
| InChIKey | JGNJZYDXUQSHRN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|