C32H33N5O5S — CID 4873728
N-[1-[1-(dimethylsulfamoyl)indol-3-yl]-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]-2-methoxybenzamide (PubChem CID 4873728) has the molecular formula C32H33N5O5S and a molecular weight of 599.71 g/mol. Its IUPAC name is N-[1-[1-(dimethylsulfamoyl)indol-3-yl]-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]-2-methoxybenzamide.
| Compound Name | N-[1-[1-(dimethylsulfamoyl)indol-3-yl]-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4873728 |
| Molecular Formula | C32H33N5O5S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | N-[1-[1-(dimethylsulfamoyl)indol-3-yl]-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(=Cc1cn(S(=O)(=O)N(C)C)c2ccccc12)C(=O)NCCc1c[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C32H33N5O5S/c1-21-13-14-27-26(17-21)22(19-34-27)15-16-33-32(39)28(35-31(38)25-10-6-8-12-30(25)42-4)18-23-20-37(43(40,41)36(2)3)29-11-7-5-9-24(23)29/h5-14,17-20,34H,15-16H2,1-4H3,(H,33,39)(H,35,38) |
| InChIKey | VVENCBAJZHSZFY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|