C28H27N3O2 — CID 2245782
N-[(Z)-3-[2-(1H-indol-3-yl)ethylamino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide (PubChem CID 2245782) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[(Z)-3-[2-(1H-indol-3-yl)ethylamino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide.
| Compound Name | N-[(Z)-3-[2-(1H-indol-3-yl)ethylamino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 2245782 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[(Z)-3-[2-(1H-indol-3-yl)ethylamino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide |
| SMILES | Cc1ccc(/C=C(\NC(=O)c2cccc(C)c2)C(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H27N3O2/c1-19-10-12-21(13-11-19)17-26(31-27(32)22-7-5-6-20(2)16-22)28(33)29-15-14-23-18-30-25-9-4-3-8-24(23)25/h3-13,16-18,30H,14-15H2,1-2H3,(H,29,33)(H,31,32)/b26-17- |
| InChIKey | IMOGPPWWQDCTOO-ONUIUJJFSA-N |
| XLogP | 4.91 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|