C29H26N4O2 — CID 3844321
N-[3-[2-(1H-indol-3-yl)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3844321) has the molecular formula C29H26N4O2 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[3-[2-(1H-indol-3-yl)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-(1H-indol-3-yl)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3844321 |
| Molecular Formula | C29H26N4O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N-[3-[2-(1H-indol-3-yl)ethylamino]-1-(1-methylindol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cn1cc(C=C(NC(=O)c2ccccc2)C(=O)NCCc2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C29H26N4O2/c1-33-19-22(24-12-6-8-14-27(24)33)17-26(32-28(34)20-9-3-2-4-10-20)29(35)30-16-15-21-18-31-25-13-7-5-11-23(21)25/h2-14,17-19,31H,15-16H2,1H3,(H,30,35)(H,32,34) |
| InChIKey | XOTWCCUIMIWUTI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|