C30H27FN4O2 — CID 17038047
N-[(Z)-1-(1-ethylindol-3-yl)-3-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 17038047) has the molecular formula C30H27FN4O2 and a molecular weight of 494.57 g/mol. Its IUPAC name is N-[(Z)-1-(1-ethylindol-3-yl)-3-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(1-ethylindol-3-yl)-3-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 17038047 |
| Molecular Formula | C30H27FN4O2 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-[(Z)-1-(1-ethylindol-3-yl)-3-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCn1cc(/C=C(\NC(=O)c2ccccc2)C(=O)NCCc2c[nH]c3cc(F)ccc23)c2ccccc21 |
| InChI | InChI=1S/C30H27FN4O2/c1-2-35-19-22(25-10-6-7-11-28(25)35)16-27(34-29(36)20-8-4-3-5-9-20)30(37)32-15-14-21-18-33-26-17-23(31)12-13-24(21)26/h3-13,16-19,33H,2,14-15H2,1H3,(H,32,37)(H,34,36)/b27-16- |
| InChIKey | WVHKNFCQNCPWLW-YUMHPJSZSA-N |
| XLogP | 5.41 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|