C28H27N3O2 — CID 46262121
N-[(Z)-3-(benzylamino)-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-4-methylbenzamide (PubChem CID 46262121) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[(Z)-3-(benzylamino)-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-4-methylbenzamide.
| Compound Name | N-[(Z)-3-(benzylamino)-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 46262121 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[(Z)-3-(benzylamino)-1-(1-ethylindol-3-yl)-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
| SMILES | CCn1cc(/C=C(\NC(=O)c2ccc(C)cc2)C(=O)NCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H27N3O2/c1-3-31-19-23(24-11-7-8-12-26(24)31)17-25(28(33)29-18-21-9-5-4-6-10-21)30-27(32)22-15-13-20(2)14-16-22/h4-17,19H,3,18H2,1-2H3,(H,29,33)(H,30,32)/b25-17- |
| InChIKey | QIAOQQAAKFVBGT-UQQQWYQISA-N |
| XLogP | 5.06 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|