C24H27N3O4 — CID 46262137
N-[(Z)-1-(1-ethylindol-3-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide (PubChem CID 46262137) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[(Z)-1-(1-ethylindol-3-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide.
| Compound Name | N-[(Z)-1-(1-ethylindol-3-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 46262137 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[(Z)-1-(1-ethylindol-3-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide |
| SMILES | CCn1cc(/C=C(\NC(=O)c2ccccc2OC)C(=O)NCCCO)c2ccccc21 |
| InChI | InChI=1S/C24H27N3O4/c1-3-27-16-17(18-9-4-6-11-21(18)27)15-20(24(30)25-13-8-14-28)26-23(29)19-10-5-7-12-22(19)31-2/h4-7,9-12,15-16,28H,3,8,13-14H2,1-2H3,(H,25,30)(H,26,29)/b20-15- |
| InChIKey | OVTZFHPMRSKNFG-HKWRFOASSA-N |
| XLogP | 2.94 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|