C23H24ClN3O2 — CID 46262104
2-chloro-N-[(Z)-1-(1-ethylindol-3-yl)-3-oxo-3-(propan-2-ylamino)prop-1-en-2-yl]benzamide (PubChem CID 46262104) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-1-(1-ethylindol-3-yl)-3-oxo-3-(propan-2-ylamino)prop-1-en-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(Z)-1-(1-ethylindol-3-yl)-3-oxo-3-(propan-2-ylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46262104 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-chloro-N-[(Z)-1-(1-ethylindol-3-yl)-3-oxo-3-(propan-2-ylamino)prop-1-en-2-yl]benzamide |
| SMILES | CCn1cc(/C=C(\NC(=O)c2ccccc2Cl)C(=O)NC(C)C)c2ccccc21 |
| InChI | InChI=1S/C23H24ClN3O2/c1-4-27-14-16(17-9-6-8-12-21(17)27)13-20(23(29)25-15(2)3)26-22(28)18-10-5-7-11-19(18)24/h5-15H,4H2,1-3H3,(H,25,29)(H,26,28)/b20-13- |
| InChIKey | RVXCAVGOZCKIAX-MOSHPQCFSA-N |
| XLogP | 4.61 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|