C23H24Cl2N4O2 — CID 3429939
3,4-dichloro-N-[1-[2-[(1-ethylindol-3-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3429939) has the molecular formula C23H24Cl2N4O2 and a molecular weight of 459.38 g/mol. Its IUPAC name is 3,4-dichloro-N-[1-[2-[(1-ethylindol-3-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[1-[2-[(1-ethylindol-3-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3429939 |
| Molecular Formula | C23H24Cl2N4O2 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 3,4-dichloro-N-[1-[2-[(1-ethylindol-3-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCn1cc(C=NNC(=O)C(NC(=O)c2ccc(Cl)c(Cl)c2)C(C)C)c2ccccc21 |
| InChI | InChI=1S/C23H24Cl2N4O2/c1-4-29-13-16(17-7-5-6-8-20(17)29)12-26-28-23(31)21(14(2)3)27-22(30)15-9-10-18(24)19(25)11-15/h5-14,21H,4H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | FJVRAPWLATUYDG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|