C29H28Cl2N4O2 — CID 6090625
3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 6090625) has the molecular formula C29H28Cl2N4O2 and a molecular weight of 535.48 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 6090625 |
| Molecular Formula | C29H28Cl2N4O2 |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1cccc(Cn2cc(/C=N\NC(=O)C(NC(=O)c3ccc(Cl)c(Cl)c3)C(C)C)c3ccccc32)c1 |
| InChI | InChI=1S/C29H28Cl2N4O2/c1-18(2)27(33-28(36)21-11-12-24(30)25(31)14-21)29(37)34-32-15-22-17-35(26-10-5-4-9-23(22)26)16-20-8-6-7-19(3)13-20/h4-15,17-18,27H,16H2,1-3H3,(H,33,36)(H,34,37)/b32-15- |
| InChIKey | YTQUIDUZNZPXOW-CNCDYAKUSA-N |
| XLogP | 6.21 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|