C24H18Cl3N3O — CID 126059458
2-chloro-N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-methylbenzamide (PubChem CID 126059458) has the molecular formula C24H18Cl3N3O and a molecular weight of 470.79 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 126059458 |
| Molecular Formula | C24H18Cl3N3O |
| Molecular Weight | 470.79 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 2-chloro-N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/N=C\c2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C24H18Cl3N3O/c1-15-6-8-19(21(26)10-15)24(31)29-28-12-17-14-30(23-5-3-2-4-18(17)23)13-16-7-9-20(25)22(27)11-16/h2-12,14H,13H2,1H3,(H,29,31)/b28-12- |
| InChIKey | WQALZCNSBHDNCO-NVJOKUIPSA-N |
| XLogP | 6.72 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.79 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|