C24H19Cl2N3O3 — CID 126395139
N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide (PubChem CID 126395139) has the molecular formula C24H19Cl2N3O3 and a molecular weight of 468.34 g/mol. Its IUPAC name is N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 126395139 |
| Molecular Formula | C24H19Cl2N3O3 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)c(O)c1 |
| InChI | InChI=1S/C24H19Cl2N3O3/c1-32-17-7-8-19(23(30)11-17)24(31)28-27-12-16-14-29(22-5-3-2-4-18(16)22)13-15-6-9-20(25)21(26)10-15/h2-12,14,30H,13H2,1H3,(H,28,31)/b27-12- |
| InChIKey | FOCRFUKOSNBGQG-PPDIBHTLSA-N |
| XLogP | 5.47 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|