C25H20Cl2N4O2 — CID 4535477
4-acetamido-N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]benzamide (PubChem CID 4535477) has the molecular formula C25H20Cl2N4O2 and a molecular weight of 479.37 g/mol. Its IUPAC name is 4-acetamido-N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-acetamido-N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4535477 |
| Molecular Formula | C25H20Cl2N4O2 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 4-acetamido-N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NN=Cc2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H20Cl2N4O2/c1-16(32)29-20-9-7-18(8-10-20)25(33)30-28-13-19-15-31(24-5-3-2-4-21(19)24)14-17-6-11-22(26)23(27)12-17/h2-13,15H,14H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | XFMXTAHCVIMOFB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|