C21H16Cl2N4 — CID 21208933
N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]pyridin-4-amine (PubChem CID 21208933) has the molecular formula C21H16Cl2N4 and a molecular weight of 395.29 g/mol. Its IUPAC name is N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]pyridin-4-amine.
| Compound Name | N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]pyridin-4-amine |
|---|---|
| PubChem CID | 21208933 |
| Molecular Formula | C21H16Cl2N4 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | N-[(Z)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]pyridin-4-amine |
| SMILES | Clc1ccc(Cn2cc(/C=N\Nc3ccncc3)c3ccccc32)cc1Cl |
| InChI | InChI=1S/C21H16Cl2N4/c22-19-6-5-15(11-20(19)23)13-27-14-16(18-3-1-2-4-21(18)27)12-25-26-17-7-9-24-10-8-17/h1-12,14H,13H2,(H,24,26)/b25-12- |
| InChIKey | SLXARPSZMATFFQ-ROTLSHHCSA-N |
| XLogP | 5.84 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|