C23H18ClN3O2 — CID 3701627
4-[2-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]benzoic acid (PubChem CID 3701627) has the molecular formula C23H18ClN3O2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 4-[2-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 3701627 |
| Molecular Formula | C23H18ClN3O2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-[2-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccc(NN=Cc2cn(Cc3ccccc3Cl)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H18ClN3O2/c24-21-7-3-1-5-17(21)14-27-15-18(20-6-2-4-8-22(20)27)13-25-26-19-11-9-16(10-12-19)23(28)29/h1-13,15,26H,14H2,(H,28,29) |
| InChIKey | NZPMLNHIMIYNBD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|