C26H22ClN3O — CID 6577818
trans-(1S,2S)-N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 6577818) has the molecular formula C26H22ClN3O and a molecular weight of 427.94 g/mol. Its IUPAC name is trans-(1S,2S)-N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6577818 |
| Molecular Formula | C26H22ClN3O |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | trans-(1S,2S)-N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1cn(Cc2ccccc2Cl)c2ccccc12)[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H22ClN3O/c27-24-12-6-4-10-19(24)16-30-17-20(21-11-5-7-13-25(21)30)15-28-29-26(31)23-14-22(23)18-8-2-1-3-9-18/h1-13,15,17,22-23H,14,16H2,(H,29,31)/b28-15-/t22-,23+/m1/s1 |
| InChIKey | LGHQRFLPTOEMKK-LBHTXDQHSA-N |
| XLogP | 5.60 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|