C24H21ClN4O — CID 126385953
2-anilino-N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]acetamide (PubChem CID 126385953) has the molecular formula C24H21ClN4O and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-anilino-N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126385953 |
| Molecular Formula | C24H21ClN4O |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-anilino-N-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]acetamide |
| SMILES | O=C(CNc1ccccc1)N/N=C\c1cn(Cc2ccccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C24H21ClN4O/c25-22-12-6-4-8-18(22)16-29-17-19(21-11-5-7-13-23(21)29)14-27-28-24(30)15-26-20-9-2-1-3-10-20/h1-14,17,26H,15-16H2,(H,28,30)/b27-14- |
| InChIKey | LUYULSHBFPRNRY-VYYCAZPPSA-N |
| XLogP | 4.91 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|