C28H22ClN3OS — CID 126220780
2-(4-chlorophenyl)sulfanyl-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]acetamide (PubChem CID 126220780) has the molecular formula C28H22ClN3OS and a molecular weight of 484.02 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126220780 |
| Molecular Formula | C28H22ClN3OS |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)N/N=C\c1cn(Cc2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C28H22ClN3OS/c29-23-12-14-24(15-13-23)34-19-28(33)31-30-16-22-18-32(27-11-4-3-10-26(22)27)17-21-8-5-7-20-6-1-2-9-25(20)21/h1-16,18H,17,19H2,(H,31,33)/b30-16- |
| InChIKey | WETMPCKUBTZRRA-UHBFCERESA-N |
| XLogP | 6.74 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|