C24H18Cl3N3O — CID 126149478
2-(4-chlorophenyl)-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]acetamide (PubChem CID 126149478) has the molecular formula C24H18Cl3N3O and a molecular weight of 470.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126149478 |
| Molecular Formula | C24H18Cl3N3O |
| Molecular Weight | 470.79 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)N/N=C\c1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C24H18Cl3N3O/c25-19-8-5-16(6-9-19)11-24(31)29-28-13-18-15-30(23-4-2-1-3-21(18)23)14-17-7-10-20(26)12-22(17)27/h1-10,12-13,15H,11,14H2,(H,29,31)/b28-13- |
| InChIKey | VTLDQTCFIKRZDK-QDTIIGTASA-N |
| XLogP | 6.34 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.79 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|