C25H21Cl2N3O2 — CID 17246263
N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-ethoxybenzamide (PubChem CID 17246263) has the molecular formula C25H21Cl2N3O2 and a molecular weight of 466.37 g/mol. Its IUPAC name is N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-ethoxybenzamide.
| Compound Name | N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 17246263 |
| Molecular Formula | C25H21Cl2N3O2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | N-[(E)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cn(Cc3ccc(Cl)cc3Cl)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H21Cl2N3O2/c1-2-32-21-11-8-17(9-12-21)25(31)29-28-14-19-16-30(24-6-4-3-5-22(19)24)15-18-7-10-20(26)13-23(18)27/h3-14,16H,2,15H2,1H3,(H,29,31)/b28-14+ |
| InChIKey | GVBVDTNCSFIOJG-CCVNUDIWSA-N |
| XLogP | 6.16 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|