C28H21Cl2N3O2 — CID 126377852
N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-methoxynaphthalene-2-carboxamide (PubChem CID 126377852) has the molecular formula C28H21Cl2N3O2 and a molecular weight of 502.40 g/mol. Its IUPAC name is N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 126377852 |
| Molecular Formula | C28H21Cl2N3O2 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)N/N=C\c1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C28H21Cl2N3O2/c1-35-27-13-19-7-3-2-6-18(19)12-24(27)28(34)32-31-15-21-17-33(26-9-5-4-8-23(21)26)16-20-10-11-22(29)14-25(20)30/h2-15,17H,16H2,1H3,(H,32,34)/b31-15- |
| InChIKey | PETODKBVLXORMH-BVMLUPFRSA-N |
| XLogP | 6.92 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|